C11H17F3N2 — CID 63226567
3,3,3-trifluoro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]propan-1-amine (PubChem CID 63226567) has the molecular formula C11H17F3N2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63226567 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3,3,3-trifluoro-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]propan-1-amine |
| SMILES | Cc1cc(CNCCC(F)(F)F)c(C)n1C |
| InChI | InChI=1S/C11H17F3N2/c1-8-6-10(9(2)16(8)3)7-15-5-4-11(12,13)14/h6,15H,4-5,7H2,1-3H3 |
| InChIKey | BLPYHGFLQBAHMM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|