About 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide
3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide (PubChem CID 63226727) has the molecular formula C6H13F3N2O2S
and a molecular weight of 234.24 g/mol. Its IUPAC name is 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide |
| PubChem CID | 63226727 |
| Molecular Formula | C6H13F3N2O2S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide |
| SMILES | NCCCS(=O)(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O2S/c7-6(8,9)2-4-11-14(12,13)5-1-3-10/h11H,1-5,10H2 |
| InChIKey | TXALSELUPYXPRG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide?
The IUPAC name of 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide (CID 63226727) is 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide.
What is the SMILES notation for 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide?
The canonical SMILES for 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide is NCCCS(=O)(=O)NCCC(F)(F)F.
What is the InChIKey of 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide?
The InChIKey is TXALSELUPYXPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3N2O2S/c7-6(8,9)2-4-11-14(12,13)5-1-3-10/h11H,1-5,10H2.
What are the key properties of 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide?
3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide has a molecular weight of 234.24 g/mol, XLogP of 0.21, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,3,3-trifluoropropyl)propane-1-sulfonamide is sourced from PubChem (CID 63226727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).