About 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one
1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one (PubChem CID 63226732) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one |
| PubChem CID | 63226732 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one |
| SMILES | Cn1ccnc(NCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C8H10F3N3O/c1-14-5-4-13-6(7(14)15)12-3-2-8(9,10)11/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | MWTTUNRQIZEQLQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one?
The IUPAC name of 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one (CID 63226732) is 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one.
What is the SMILES notation for 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one?
The canonical SMILES for 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one is Cn1ccnc(NCCC(F)(F)F)c1=O.
What is the InChIKey of 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one?
The InChIKey is MWTTUNRQIZEQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O/c1-14-5-4-13-6(7(14)15)12-3-2-8(9,10)11/h4-5H,2-3H2,1H3,(H,12,13).
What are the key properties of 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one?
1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one has a molecular weight of 221.18 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(3,3,3-trifluoropropylamino)pyrazin-2-one is sourced from PubChem (CID 63226732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).