About N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide
N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide (PubChem CID 63226818) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide.
Molecular Properties
| Compound Name | N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide |
| PubChem CID | 63226818 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide |
| SMILES | C=CCNC(=O)C(C)NCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c1-3-5-14-8(15)7(2)13-6-4-9(10,11)12/h3,7,13H,1,4-6H2,2H3,(H,14,15) |
| InChIKey | ZXQDKIBTHJTRNC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide?
The IUPAC name of N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide (CID 63226818) is N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide.
What is the SMILES notation for N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide?
The canonical SMILES for N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide is C=CCNC(=O)C(C)NCCC(F)(F)F.
What is the InChIKey of N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide?
The InChIKey is ZXQDKIBTHJTRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O/c1-3-5-14-8(15)7(2)13-6-4-9(10,11)12/h3,7,13H,1,4-6H2,2H3,(H,14,15).
What are the key properties of N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide?
N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide has a molecular weight of 224.23 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-2-(3,3,3-trifluoropropylamino)propanamide is sourced from PubChem (CID 63226818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).