C6H6ClF3N2O2S2 — CID 63226947
2-chloro-N-(3,3,3-trifluoropropyl)-1,3-thiazole-5-sulfonamide (PubChem CID 63226947) has the molecular formula C6H6ClF3N2O2S2 and a molecular weight of 294.71 g/mol. Its IUPAC name is 2-chloro-N-(3,3,3-trifluoropropyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(3,3,3-trifluoropropyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63226947 |
| Molecular Formula | C6H6ClF3N2O2S2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 2-chloro-N-(3,3,3-trifluoropropyl)-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCC(F)(F)F)c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H6ClF3N2O2S2/c7-5-11-3-4(15-5)16(13,14)12-2-1-6(8,9)10/h3,12H,1-2H2 |
| InChIKey | GMIDHUGWUUKUMS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |