C6H7F3N4O2 — CID 63227129
6-(3,3,3-trifluoropropylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 63227129) has the molecular formula C6H7F3N4O2 and a molecular weight of 224.14 g/mol. Its IUPAC name is 6-(3,3,3-trifluoropropylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(3,3,3-trifluoropropylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 63227129 |
| Molecular Formula | C6H7F3N4O2 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 6-(3,3,3-trifluoropropylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H7F3N4O2/c7-6(8,9)1-2-10-3-4(14)11-5(15)13-12-3/h1-2H2,(H,10,12)(H2,11,13,14,15) |
| InChIKey | GHQGQMSLHWESEU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |