C12H10F3N3O2 — CID 63227223
8-nitro-N-(3,3,3-trifluoropropyl)isoquinolin-5-amine (PubChem CID 63227223) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 8-nitro-N-(3,3,3-trifluoropropyl)isoquinolin-5-amine.
| Compound Name | 8-nitro-N-(3,3,3-trifluoropropyl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 63227223 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 8-nitro-N-(3,3,3-trifluoropropyl)isoquinolin-5-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCC(F)(F)F)c2ccncc12 |
| InChI | InChI=1S/C12H10F3N3O2/c13-12(14,15)4-6-17-10-1-2-11(18(19)20)9-7-16-5-3-8(9)10/h1-3,5,7,17H,4,6H2 |
| InChIKey | RWZXWDVEAJQJSP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|