C10H8Cl2F3N5 — CID 63227292
2,3-dichloro-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline (PubChem CID 63227292) has the molecular formula C10H8Cl2F3N5 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2,3-dichloro-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline.
| Compound Name | 2,3-dichloro-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 63227292 |
| Molecular Formula | C10H8Cl2F3N5 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2,3-dichloro-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
| SMILES | Nc1cc(-c2nnnn2CCC(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl2F3N5/c11-6-3-5(4-7(16)8(6)12)9-17-18-19-20(9)2-1-10(13,14)15/h3-4H,1-2,16H2 |
| InChIKey | MEJVIOMXYZHDSJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|