C14H20F3N3O — CID 63227876
1-[3-[1-(ethylamino)ethyl]phenyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 63227876) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-[3-[1-(ethylamino)ethyl]phenyl]-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-[3-[1-(ethylamino)ethyl]phenyl]-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 63227876 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[3-[1-(ethylamino)ethyl]phenyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | CCNC(C)c1cccc(NC(=O)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3N3O/c1-3-18-10(2)11-5-4-6-12(9-11)20-13(21)19-8-7-14(15,16)17/h4-6,9-10,18H,3,7-8H2,1-2H3,(H2,19,20,21) |
| InChIKey | KPLCGELEAPKSDB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |