About N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide
N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide (PubChem CID 63228038) has the molecular formula C7H14F3N3O2S
and a molecular weight of 261.27 g/mol. Its IUPAC name is N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide |
| PubChem CID | 63228038 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide |
| SMILES | O=S(=O)(NCCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C7H14F3N3O2S/c8-7(9,10)1-2-12-16(14,15)13-5-3-11-4-6-13/h11-12H,1-6H2 |
| InChIKey | YTQIYPZHBYWVKA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide?
The IUPAC name of N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide (CID 63228038) is N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide.
What is the SMILES notation for N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide?
The canonical SMILES for N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide is O=S(=O)(NCCC(F)(F)F)N1CCNCC1.
What is the InChIKey of N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide?
The InChIKey is YTQIYPZHBYWVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3O2S/c8-7(9,10)1-2-12-16(14,15)13-5-3-11-4-6-13/h11-12H,1-6H2.
What are the key properties of N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide?
N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide has a molecular weight of 261.27 g/mol, XLogP of -0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide is sourced from PubChem (CID 63228038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).