About 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide
4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide (PubChem CID 63228692) has the molecular formula C10H14F3N3O
and a molecular weight of 249.24 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide |
| PubChem CID | 63228692 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O/c1-2-16-6-7(14)5-8(16)9(17)15-4-3-10(11,12)13/h5-6H,2-4,14H2,1H3,(H,15,17) |
| InChIKey | IEPRPEVWUWKVNU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide?
The IUPAC name of 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide (CID 63228692) is 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide.
What is the SMILES notation for 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide?
The canonical SMILES for 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide is CCn1cc(N)cc1C(=O)NCCC(F)(F)F.
What is the InChIKey of 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide?
The InChIKey is IEPRPEVWUWKVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O/c1-2-16-6-7(14)5-8(16)9(17)15-4-3-10(11,12)13/h5-6H,2-4,14H2,1H3,(H,15,17).
What are the key properties of 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide?
4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide has a molecular weight of 249.24 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-ethyl-N-(3,3,3-trifluoropropyl)pyrrole-2-carboxamide is sourced from PubChem (CID 63228692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).