C9H7N5S2 — CID 63229248
2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-benzothiazol-6-amine (PubChem CID 63229248) has the molecular formula C9H7N5S2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 63229248 |
| Molecular Formula | C9H7N5S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(Sc3ncn[nH]3)sc2c1 |
| InChI | InChI=1S/C9H7N5S2/c10-5-1-2-6-7(3-5)15-9(13-6)16-8-11-4-12-14-8/h1-4H,10H2,(H,11,12,14) |
| InChIKey | RGQBHJZUVDXURS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|