C18H23N3 — CID 63229307
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-methylquinolin-2-amine (PubChem CID 63229307) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-methylquinolin-2-amine.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-methylquinolin-2-amine |
|---|---|
| PubChem CID | 63229307 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-methylquinolin-2-amine |
| SMILES | Cc1cc2ccccc2nc1NC1CCN2CCCCC12 |
| InChI | InChI=1S/C18H23N3/c1-13-12-14-6-2-3-7-15(14)19-18(13)20-16-9-11-21-10-5-4-8-17(16)21/h2-3,6-7,12,16-17H,4-5,8-11H2,1H3,(H,19,20) |
| InChIKey | QTYXZEUWXGHIHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |