C17H20N2O2 — CID 63229377
3-ethyl-1-(3-methylquinolin-2-yl)pyrrolidine-3-carboxylic acid (PubChem CID 63229377) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-ethyl-1-(3-methylquinolin-2-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-ethyl-1-(3-methylquinolin-2-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63229377 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-ethyl-1-(3-methylquinolin-2-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(c2nc3ccccc3cc2C)C1 |
| InChI | InChI=1S/C17H20N2O2/c1-3-17(16(20)21)8-9-19(11-17)15-12(2)10-13-6-4-5-7-14(13)18-15/h4-7,10H,3,8-9,11H2,1-2H3,(H,20,21) |
| InChIKey | RWGCGAFCINMZEH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |