C14H13Cl2N — CID 63231750
2-chloro-3-(chloromethyl)-7,8,9,10-tetrahydrobenzo[h]quinoline (PubChem CID 63231750) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-chloro-3-(chloromethyl)-7,8,9,10-tetrahydrobenzo[h]quinoline.
| Compound Name | 2-chloro-3-(chloromethyl)-7,8,9,10-tetrahydrobenzo[h]quinoline |
|---|---|
| PubChem CID | 63231750 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-chloro-3-(chloromethyl)-7,8,9,10-tetrahydrobenzo[h]quinoline |
| SMILES | ClCc1cc2ccc3c(c2nc1Cl)CCCC3 |
| InChI | InChI=1S/C14H13Cl2N/c15-8-11-7-10-6-5-9-3-1-2-4-12(9)13(10)17-14(11)16/h5-7H,1-4,8H2 |
| InChIKey | XERBRYSNDLSXGL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|