About 3-methyl-N-propyl-1,7-phenanthrolin-2-amine
3-methyl-N-propyl-1,7-phenanthrolin-2-amine (PubChem CID 63231772) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-methyl-N-propyl-1,7-phenanthrolin-2-amine.
Molecular Properties
| Compound Name | 3-methyl-N-propyl-1,7-phenanthrolin-2-amine |
| PubChem CID | 63231772 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-methyl-N-propyl-1,7-phenanthrolin-2-amine |
| SMILES | CCCNc1nc2c(ccc3ncccc32)cc1C |
| InChI | InChI=1S/C16H17N3/c1-3-8-18-16-11(2)10-12-6-7-14-13(15(12)19-16)5-4-9-17-14/h4-7,9-10H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | ILALNVIWVBAVPZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-propyl-1,7-phenanthrolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-propyl-1,7-phenanthrolin-2-amine?
The IUPAC name of 3-methyl-N-propyl-1,7-phenanthrolin-2-amine (CID 63231772) is 3-methyl-N-propyl-1,7-phenanthrolin-2-amine.
What is the SMILES notation for 3-methyl-N-propyl-1,7-phenanthrolin-2-amine?
The canonical SMILES for 3-methyl-N-propyl-1,7-phenanthrolin-2-amine is CCCNc1nc2c(ccc3ncccc32)cc1C.
What is the InChIKey of 3-methyl-N-propyl-1,7-phenanthrolin-2-amine?
The InChIKey is ILALNVIWVBAVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-3-8-18-16-11(2)10-12-6-7-14-13(15(12)19-16)5-4-9-17-14/h4-7,9-10H,3,8H2,1-2H3,(H,18,19).
What are the key properties of 3-methyl-N-propyl-1,7-phenanthrolin-2-amine?
3-methyl-N-propyl-1,7-phenanthrolin-2-amine has a molecular weight of 251.33 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-propyl-1,7-phenanthrolin-2-amine is sourced from PubChem (CID 63231772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).