C13H13F3N2O — CID 63232155
3-ethyl-8-(2,2,2-trifluoroethoxy)quinolin-2-amine (PubChem CID 63232155) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-ethyl-8-(2,2,2-trifluoroethoxy)quinolin-2-amine.
| Compound Name | 3-ethyl-8-(2,2,2-trifluoroethoxy)quinolin-2-amine |
|---|---|
| PubChem CID | 63232155 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-ethyl-8-(2,2,2-trifluoroethoxy)quinolin-2-amine |
| SMILES | CCc1cc2cccc(OCC(F)(F)F)c2nc1N |
| InChI | InChI=1S/C13H13F3N2O/c1-2-8-6-9-4-3-5-10(11(9)18-12(8)17)19-7-13(14,15)16/h3-6H,2,7H2,1H3,(H2,17,18) |
| InChIKey | VIYRJTJVYCLPNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |