About [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine
[3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine (PubChem CID 63232653) has the molecular formula C15H16N4S
and a molecular weight of 284.39 g/mol. Its IUPAC name is [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine |
| PubChem CID | 63232653 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine |
| SMILES | CCCc1cc2cc(-c3nccs3)ccc2nc1NN |
| InChI | InChI=1S/C15H16N4S/c1-2-3-10-8-12-9-11(15-17-6-7-20-15)4-5-13(12)18-14(10)19-16/h4-9H,2-3,16H2,1H3,(H,18,19) |
| InChIKey | QSKVUAYXPOSFIJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine?
The IUPAC name of [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine (CID 63232653) is [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine.
What is the SMILES notation for [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine?
The canonical SMILES for [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine is CCCc1cc2cc(-c3nccs3)ccc2nc1NN.
What is the InChIKey of [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine?
The InChIKey is QSKVUAYXPOSFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4S/c1-2-3-10-8-12-9-11(15-17-6-7-20-15)4-5-13(12)18-14(10)19-16/h4-9H,2-3,16H2,1H3,(H,18,19).
What are the key properties of [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine?
[3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine has a molecular weight of 284.39 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-propyl-6-(1,3-thiazol-2-yl)quinolin-2-yl]hydrazine is sourced from PubChem (CID 63232653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).