About (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine
(3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine (PubChem CID 63233164) has the molecular formula C14H14N4
and a molecular weight of 238.29 g/mol. Its IUPAC name is (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine.
Molecular Properties
| Compound Name | (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine |
| PubChem CID | 63233164 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine |
| SMILES | Cc1ccc2ccc3cc(C)c(NN)nc3c2n1 |
| InChI | InChI=1S/C14H14N4/c1-8-7-11-6-5-10-4-3-9(2)16-12(10)13(11)17-14(8)18-15/h3-7H,15H2,1-2H3,(H,17,18) |
| InChIKey | DQFPMHDLVRGPMC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine?
The IUPAC name of (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine (CID 63233164) is (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine.
What is the SMILES notation for (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine?
The canonical SMILES for (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine is Cc1ccc2ccc3cc(C)c(NN)nc3c2n1.
What is the InChIKey of (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine?
The InChIKey is DQFPMHDLVRGPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4/c1-8-7-11-6-5-10-4-3-9(2)16-12(10)13(11)17-14(8)18-15/h3-7H,15H2,1-2H3,(H,17,18).
What are the key properties of (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine?
(3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine has a molecular weight of 238.29 g/mol, XLogP of 2.69, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,9-dimethyl-1,10-phenanthrolin-2-yl)hydrazine is sourced from PubChem (CID 63233164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).