About [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine
[4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine (PubChem CID 6323416) has the molecular formula C24H20N4
and a molecular weight of 364.45 g/mol. Its IUPAC name is [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine.
Molecular Properties
| Compound Name | [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine |
| PubChem CID | 6323416 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine |
| SMILES | NCc1nnc2ccccc2c1/N=C/C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N4/c25-17-23-24(21-13-7-8-14-22(21)27-28-23)26-16-15-20(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-16H,17,25H2/b26-16+ |
| InChIKey | CUWRVIIPSSUUDJ-WGOQTCKBSA-N |
| XLogP | 4.92 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine?
The IUPAC name of [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine (CID 6323416) is [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine.
What is the SMILES notation for [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine?
The canonical SMILES for [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine is NCc1nnc2ccccc2c1/N=C/C=C(c1ccccc1)c1ccccc1.
What is the InChIKey of [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine?
The InChIKey is CUWRVIIPSSUUDJ-WGOQTCKBSA-N. The full InChI is InChI=1S/C24H20N4/c25-17-23-24(21-13-7-8-14-22(21)27-28-23)26-16-15-20(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-16H,17,25H2/b26-16+.
What are the key properties of [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine?
[4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine has a molecular weight of 364.45 g/mol, XLogP of 4.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3-diphenylprop-2-enylideneamino)cinnolin-3-yl]methanamine is sourced from PubChem (CID 6323416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).