About 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one
1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one (PubChem CID 63235305) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one |
| PubChem CID | 63235305 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CC(CCN)c2ccccc21 |
| InChI | InChI=1S/C14H20N2O/c1-2-5-14(17)16-10-11(8-9-15)12-6-3-4-7-13(12)16/h3-4,6-7,11H,2,5,8-10,15H2,1H3 |
| InChIKey | AWUMNXXFOLGHJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one?
The IUPAC name of 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one (CID 63235305) is 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one.
What is the SMILES notation for 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one?
The canonical SMILES for 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one is CCCC(=O)N1CC(CCN)c2ccccc21.
What is the InChIKey of 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one?
The InChIKey is AWUMNXXFOLGHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-2-5-14(17)16-10-11(8-9-15)12-6-3-4-7-13(12)16/h3-4,6-7,11H,2,5,8-10,15H2,1H3.
What are the key properties of 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one?
1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one has a molecular weight of 232.33 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butan-1-one is sourced from PubChem (CID 63235305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).