C18H12F6N6 — CID 6323552
N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,4-triazol-3-amine (PubChem CID 6323552) has the molecular formula C18H12F6N6 and a molecular weight of 426.32 g/mol. Its IUPAC name is N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,4-triazol-3-amine.
| Compound Name | N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 6323552 |
| Molecular Formula | C18H12F6N6 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,4-triazol-3-amine |
| SMILES | FC(F)(F)c1ccccc1/C=N\Nc1nncn1/N=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F6N6/c19-17(20,21)14-7-3-1-5-12(14)9-25-28-16-29-26-11-30(16)27-10-13-6-2-4-8-15(13)18(22,23)24/h1-11H,(H,28,29)/b25-9-,27-10+ |
| InChIKey | ROPPZJWHUVCTAO-VSYQLKRDSA-N |
| XLogP | 4.64 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|