About 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide
3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide (PubChem CID 63235622) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide |
| PubChem CID | 63235622 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCN1CC(CCN)c2ccccc21 |
| InChI | InChI=1S/C16H25N3O/c1-12(2)18-16(20)8-10-19-11-13(7-9-17)14-5-3-4-6-15(14)19/h3-6,12-13H,7-11,17H2,1-2H3,(H,18,20) |
| InChIKey | ZAHSCCWWZUDOIL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide?
The IUPAC name of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide (CID 63235622) is 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide.
What is the SMILES notation for 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide?
The canonical SMILES for 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide is CC(C)NC(=O)CCN1CC(CCN)c2ccccc21.
What is the InChIKey of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide?
The InChIKey is ZAHSCCWWZUDOIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-12(2)18-16(20)8-10-19-11-13(7-9-17)14-5-3-4-6-15(14)19/h3-6,12-13H,7-11,17H2,1-2H3,(H,18,20).
What are the key properties of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide?
3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide has a molecular weight of 275.40 g/mol, XLogP of 1.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-propan-2-ylpropanamide is sourced from PubChem (CID 63235622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).