About 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid
3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid (PubChem CID 63235661) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid |
| PubChem CID | 63235661 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid |
| SMILES | CC(CC(=O)O)N1CC(CCN)c2ccccc21 |
| InChI | InChI=1S/C14H20N2O2/c1-10(8-14(17)18)16-9-11(6-7-15)12-4-2-3-5-13(12)16/h2-5,10-11H,6-9,15H2,1H3,(H,17,18) |
| InChIKey | JXCHBTWWGDHIKO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid?
The IUPAC name of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid (CID 63235661) is 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid.
What is the SMILES notation for 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid?
The canonical SMILES for 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid is CC(CC(=O)O)N1CC(CCN)c2ccccc21.
What is the InChIKey of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid?
The InChIKey is JXCHBTWWGDHIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-10(8-14(17)18)16-9-11(6-7-15)12-4-2-3-5-13(12)16/h2-5,10-11H,6-9,15H2,1H3,(H,17,18).
What are the key properties of 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid?
3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid has a molecular weight of 248.33 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]butanoic acid is sourced from PubChem (CID 63235661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).