About 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine
2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine (PubChem CID 63235883) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine |
| PubChem CID | 63235883 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine |
| SMILES | COCCN1CC(CCN)c2ccccc21 |
| InChI | InChI=1S/C13H20N2O/c1-16-9-8-15-10-11(6-7-14)12-4-2-3-5-13(12)15/h2-5,11H,6-10,14H2,1H3 |
| InChIKey | DHRPJSNNXBBOPR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine?
The IUPAC name of 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine (CID 63235883) is 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine.
What is the SMILES notation for 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine?
The canonical SMILES for 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine is COCCN1CC(CCN)c2ccccc21.
What is the InChIKey of 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine?
The InChIKey is DHRPJSNNXBBOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-16-9-8-15-10-11(6-7-14)12-4-2-3-5-13(12)15/h2-5,11H,6-10,14H2,1H3.
What are the key properties of 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine?
2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine has a molecular weight of 220.32 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-methoxyethyl)-2,3-dihydroindol-3-yl]ethanamine is sourced from PubChem (CID 63235883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).