About 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide
2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide (PubChem CID 63235972) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide.
Molecular Properties
| Compound Name | 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide |
| PubChem CID | 63235972 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN1CC(CCN)c2ccccc21 |
| InChI | InChI=1S/C15H22N4O2/c1-2-17-15(21)18-14(20)10-19-9-11(7-8-16)12-5-3-4-6-13(12)19/h3-6,11H,2,7-10,16H2,1H3,(H2,17,18,20,21) |
| InChIKey | NSWBIIRQUQNMRM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide?
The IUPAC name of 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide (CID 63235972) is 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide.
What is the SMILES notation for 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide?
The canonical SMILES for 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide is CCNC(=O)NC(=O)CN1CC(CCN)c2ccccc21.
What is the InChIKey of 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide?
The InChIKey is NSWBIIRQUQNMRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-2-17-15(21)18-14(20)10-19-9-11(7-8-16)12-5-3-4-6-13(12)19/h3-6,11H,2,7-10,16H2,1H3,(H2,17,18,20,21).
What are the key properties of 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide?
2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide has a molecular weight of 290.37 g/mol, XLogP of 0.78, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-N-(ethylcarbamoyl)acetamide is sourced from PubChem (CID 63235972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).