C14H19BrClN3O — CID 63236918
5-bromo-2-chloro-N-methyl-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide (PubChem CID 63236918) has the molecular formula C14H19BrClN3O and a molecular weight of 360.68 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-methyl-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-methyl-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63236918 |
| Molecular Formula | C14H19BrClN3O |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 5-bromo-2-chloro-N-methyl-N-[(1-methylpiperidin-4-yl)methyl]pyridine-3-carboxamide |
| SMILES | CN1CCC(CN(C)C(=O)c2cc(Br)cnc2Cl)CC1 |
| InChI | InChI=1S/C14H19BrClN3O/c1-18-5-3-10(4-6-18)9-19(2)14(20)12-7-11(15)8-17-13(12)16/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | ZKMSBRBYKMCLOE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|