About [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate
[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate (PubChem CID 6323694) has the molecular formula C10H8N6O5
and a molecular weight of 292.21 g/mol. Its IUPAC name is [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate.
Molecular Properties
| Compound Name | [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate |
| PubChem CID | 6323694 |
| Molecular Formula | C10H8N6O5 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate |
| SMILES | N/C(=N\OC(=O)c1ccccc1[N+](=O)[O-])c1nonc1N |
| InChI | InChI=1S/C10H8N6O5/c11-8(7-9(12)15-21-13-7)14-20-10(17)5-3-1-2-4-6(5)16(18)19/h1-4H,(H2,11,14)(H2,12,15) |
| InChIKey | CJNLQKDGVJCPLE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate?
The IUPAC name of [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate (CID 6323694) is [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate.
What is the SMILES notation for [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate?
The canonical SMILES for [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate is N/C(=N\OC(=O)c1ccccc1[N+](=O)[O-])c1nonc1N.
What is the InChIKey of [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate?
The InChIKey is CJNLQKDGVJCPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6O5/c11-8(7-9(12)15-21-13-7)14-20-10(17)5-3-1-2-4-6(5)16(18)19/h1-4H,(H2,11,14)(H2,12,15).
What are the key properties of [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate?
[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate has a molecular weight of 292.21 g/mol, XLogP of 0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 2-nitrobenzoate is sourced from PubChem (CID 6323694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).