C14H30N4O — CID 63236966
2-amino-2-methyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pentanamide (PubChem CID 63236966) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-amino-2-methyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pentanamide.
| Compound Name | 2-amino-2-methyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pentanamide |
|---|---|
| PubChem CID | 63236966 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 2-amino-2-methyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pentanamide |
| SMILES | CN1CCC(CN(C)CCCC(C)(N)C(N)=O)CC1 |
| InChI | InChI=1S/C14H30N4O/c1-14(16,13(15)19)7-4-8-18(3)11-12-5-9-17(2)10-6-12/h12H,4-11,16H2,1-3H3,(H2,15,19) |
| InChIKey | KHMDIIPPEXFGBS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |