About N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide
N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide (PubChem CID 6323748) has the molecular formula C17H14N2O4
and a molecular weight of 310.31 g/mol. Its IUPAC name is N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide |
| PubChem CID | 6323748 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2/OC(=O)c3c2cc(C)[nH]c3=O)cc1 |
| InChI | InChI=1S/C17H14N2O4/c1-9-7-13-14(23-17(22)15(13)16(21)18-9)8-11-3-5-12(6-4-11)19-10(2)20/h3-8H,1-2H3,(H,18,21)(H,19,20)/b14-8+ |
| InChIKey | AOUQHKWVNBKGPD-RIYZIHGNSA-N |
| XLogP | 2.31 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide?
The IUPAC name of N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide (CID 6323748) is N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide is CC(=O)Nc1ccc(/C=C2/OC(=O)c3c2cc(C)[nH]c3=O)cc1.
What is the InChIKey of N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide?
The InChIKey is AOUQHKWVNBKGPD-RIYZIHGNSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-9-7-13-14(23-17(22)15(13)16(21)18-9)8-11-3-5-12(6-4-11)19-10(2)20/h3-8H,1-2H3,(H,18,21)(H,19,20)/b14-8+.
What are the key properties of N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide?
N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide has a molecular weight of 310.31 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-(6-methyl-3,4-dioxo-5H-furo[3,4-c]pyridin-1-ylidene)methyl]phenyl]acetamide is sourced from PubChem (CID 6323748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).