About 3,4,6-triphenylpyridazine
3,4,6-triphenylpyridazine (PubChem CID 6323877) has the molecular formula C22H16N2
and a molecular weight of 308.38 g/mol. Its IUPAC name is 3,4,6-triphenylpyridazine.
Molecular Properties
| Compound Name | 3,4,6-triphenylpyridazine |
| PubChem CID | 6323877 |
| Molecular Formula | C22H16N2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3,4,6-triphenylpyridazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C22H16N2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-24-22(20)19-14-8-3-9-15-19/h1-16H |
| InChIKey | VHEZKLJOVNSLCJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4,6-triphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6-triphenylpyridazine?
The IUPAC name of 3,4,6-triphenylpyridazine (CID 6323877) is 3,4,6-triphenylpyridazine.
What is the SMILES notation for 3,4,6-triphenylpyridazine?
The canonical SMILES for 3,4,6-triphenylpyridazine is c1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)nn2)cc1.
What is the InChIKey of 3,4,6-triphenylpyridazine?
The InChIKey is VHEZKLJOVNSLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-24-22(20)19-14-8-3-9-15-19/h1-16H.
What are the key properties of 3,4,6-triphenylpyridazine?
3,4,6-triphenylpyridazine has a molecular weight of 308.38 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-triphenylpyridazine is sourced from PubChem (CID 6323877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).