C21H29ClO4 — CID 632389
10-(chloromethyl)-17-hydroxy-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 632389) has the molecular formula C21H29ClO4 and a molecular weight of 380.91 g/mol. Its IUPAC name is 10-(chloromethyl)-17-hydroxy-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 10-(chloromethyl)-17-hydroxy-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 632389 |
| Molecular Formula | C21H29ClO4 |
| Molecular Weight | 380.91 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 10-(chloromethyl)-17-hydroxy-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43CCl)C1CCC2(O)C(=O)CO |
| InChI | InChI=1S/C21H29ClO4/c1-19-7-5-17-15(16(19)6-9-21(19,26)18(25)11-23)3-2-13-10-14(24)4-8-20(13,17)12-22/h10,15-17,23,26H,2-9,11-12H2,1H3 |
| InChIKey | OJDUBRVUHXGJJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|