About 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one
4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one (PubChem CID 63239190) has the molecular formula C10H18N2O4S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one |
| PubChem CID | 63239190 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(S(=O)(=O)C2CCOCC2)CCCN1 |
| InChI | InChI=1S/C10H18N2O4S/c13-10-8-12(5-1-4-11-10)17(14,15)9-2-6-16-7-3-9/h9H,1-8H2,(H,11,13) |
| InChIKey | QXHDUNRADKSUAP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one?
The IUPAC name of 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one (CID 63239190) is 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one.
What is the SMILES notation for 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one?
The canonical SMILES for 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one is O=C1CN(S(=O)(=O)C2CCOCC2)CCCN1.
What is the InChIKey of 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one?
The InChIKey is QXHDUNRADKSUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4S/c13-10-8-12(5-1-4-11-10)17(14,15)9-2-6-16-7-3-9/h9H,1-8H2,(H,11,13).
What are the key properties of 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one?
4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one has a molecular weight of 262.33 g/mol, XLogP of -0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-4-ylsulfonyl)-1,4-diazepan-2-one is sourced from PubChem (CID 63239190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).