C14H15FN2O3S — CID 63239528
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-2-fluorobenzonitrile (PubChem CID 63239528) has the molecular formula C14H15FN2O3S and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-2-fluorobenzonitrile.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 63239528 |
| Molecular Formula | C14H15FN2O3S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(S(=O)(=O)N2CCOC3CCCC32)ccc1F |
| InChI | InChI=1S/C14H15FN2O3S/c15-12-5-4-11(8-10(12)9-16)21(18,19)17-6-7-20-14-3-1-2-13(14)17/h4-5,8,13-14H,1-3,6-7H2 |
| InChIKey | TZMOTVHVLBNTQO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |