About 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol
2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol (PubChem CID 63239582) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol |
| PubChem CID | 63239582 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol |
| SMILES | CC(C)(O)CNC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C14H27NO/c1-12(2,16)9-15-11-8-10-6-7-14(11,5)13(10,3)4/h10-11,15-16H,6-9H2,1-5H3 |
| InChIKey | SBLFWDZYWQKEJP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol?
The IUPAC name of 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol (CID 63239582) is 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol.
What is the SMILES notation for 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol?
The canonical SMILES for 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol is CC(C)(O)CNC1CC2CCC1(C)C2(C)C.
What is the InChIKey of 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol?
The InChIKey is SBLFWDZYWQKEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-12(2,16)9-15-11-8-10-6-7-14(11,5)13(10,3)4/h10-11,15-16H,6-9H2,1-5H3.
What are the key properties of 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol?
2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol has a molecular weight of 225.38 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-ol is sourced from PubChem (CID 63239582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).