C13H20FNO2 — CID 63239724
1-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylpropan-2-ol (PubChem CID 63239724) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 63239724 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylpropan-2-ol |
| SMILES | COc1ccc(C(C)NCC(C)(C)O)cc1F |
| InChI | InChI=1S/C13H20FNO2/c1-9(15-8-13(2,3)16)10-5-6-12(17-4)11(14)7-10/h5-7,9,15-16H,8H2,1-4H3 |
| InChIKey | UTAWHAJZKDPPQH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |