C18H12FNO3 — CID 6323989
4-(3-fluorophenyl)-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione (PubChem CID 6323989) has the molecular formula C18H12FNO3 and a molecular weight of 309.30 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 4-(3-fluorophenyl)-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 6323989 |
| Molecular Formula | C18H12FNO3 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(3-fluorophenyl)-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione |
| SMILES | O=C1CC(c2cccc(F)c2)c2c(c3ccccc3[nH]c2=O)O1 |
| InChI | InChI=1S/C18H12FNO3/c19-11-5-3-4-10(8-11)13-9-15(21)23-17-12-6-1-2-7-14(12)20-18(22)16(13)17/h1-8,13H,9H2,(H,20,22) |
| InChIKey | LFXSLAPNGXZTTQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |