C12H23ClN2 — CID 63241265
N-[[1-(2-chloroprop-2-enyl)piperidin-3-yl]methyl]propan-2-amine (PubChem CID 63241265) has the molecular formula C12H23ClN2 and a molecular weight of 230.78 g/mol. Its IUPAC name is N-[[1-(2-chloroprop-2-enyl)piperidin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(2-chloroprop-2-enyl)piperidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63241265 |
| Molecular Formula | C12H23ClN2 |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-[[1-(2-chloroprop-2-enyl)piperidin-3-yl]methyl]propan-2-amine |
| SMILES | C=C(Cl)CN1CCCC(CNC(C)C)C1 |
| InChI | InChI=1S/C12H23ClN2/c1-10(2)14-7-12-5-4-6-15(9-12)8-11(3)13/h10,12,14H,3-9H2,1-2H3 |
| InChIKey | HNBQEBTYEJREHB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |