C15H30N2 — CID 63243515
4-methyl-1-[(4-methylcyclohexyl)methyl]-1,5-diazocane (PubChem CID 63243515) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 4-methyl-1-[(4-methylcyclohexyl)methyl]-1,5-diazocane.
| Compound Name | 4-methyl-1-[(4-methylcyclohexyl)methyl]-1,5-diazocane |
|---|---|
| PubChem CID | 63243515 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 4-methyl-1-[(4-methylcyclohexyl)methyl]-1,5-diazocane |
| SMILES | CC1CCC(CN2CCCNC(C)CC2)CC1 |
| InChI | InChI=1S/C15H30N2/c1-13-4-6-15(7-5-13)12-17-10-3-9-16-14(2)8-11-17/h13-16H,3-12H2,1-2H3 |
| InChIKey | SUNCJKNMDLTTEH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |