C16H23FN2O — CID 63243623
N-(4-fluorophenyl)-2-[(4-methylcyclohexyl)methylamino]acetamide (PubChem CID 63243623) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(4-methylcyclohexyl)methylamino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(4-methylcyclohexyl)methylamino]acetamide |
|---|---|
| PubChem CID | 63243623 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(4-methylcyclohexyl)methylamino]acetamide |
| SMILES | CC1CCC(CNCC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O/c1-12-2-4-13(5-3-12)10-18-11-16(20)19-15-8-6-14(17)7-9-15/h6-9,12-13,18H,2-5,10-11H2,1H3,(H,19,20) |
| InChIKey | QJVZNJBKMMZMLY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |