C18H13N5OS — CID 6324480
4-(11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-1H-quinolin-2-one (PubChem CID 6324480) has the molecular formula C18H13N5OS and a molecular weight of 347.40 g/mol. Its IUPAC name is 4-(11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-1H-quinolin-2-one.
| Compound Name | 4-(11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 6324480 |
| Molecular Formula | C18H13N5OS |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-(11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-1H-quinolin-2-one |
| SMILES | Cc1sc2ncn3nc(-c4cc(=O)[nH]c5ccccc45)nc3c2c1C |
| InChI | InChI=1S/C18H13N5OS/c1-9-10(2)25-18-15(9)17-21-16(22-23(17)8-19-18)12-7-14(24)20-13-6-4-3-5-11(12)13/h3-8H,1-2H3,(H,20,24) |
| InChIKey | CMYROZYNPHQMTB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |