About 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide
2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide (PubChem CID 63246304) has the molecular formula C9H20N2O4S
and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide |
| PubChem CID | 63246304 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)N(C)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C9H20N2O4S/c1-3-15-4-5-16(13,14)11(2)8-6-10-7-9(8)12/h8-10,12H,3-7H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | SZGXHJVJGGVNBU-RKDXNWHRSA-N |
| XLogP | -1.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide?
The IUPAC name of 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide (CID 63246304) is 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide.
What is the SMILES notation for 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide?
The canonical SMILES for 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide is CCOCCS(=O)(=O)N(C)[C@@H]1CNC[C@H]1O.
What is the InChIKey of 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide?
The InChIKey is SZGXHJVJGGVNBU-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H20N2O4S/c1-3-15-4-5-16(13,14)11(2)8-6-10-7-9(8)12/h8-10,12H,3-7H2,1-2H3/t8-,9-/m1/s1.
What are the key properties of 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide?
2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide has a molecular weight of 252.34 g/mol, XLogP of -1.38, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylethanesulfonamide is sourced from PubChem (CID 63246304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).