C15H13NO3 — CID 6324683
4-cyclopropyl-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione (PubChem CID 6324683) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-cyclopropyl-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 4-cyclopropyl-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 6324683 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-cyclopropyl-4,6-dihydro-3H-pyrano[3,2-c]quinoline-2,5-dione |
| SMILES | O=C1CC(C2CC2)c2c(c3ccccc3[nH]c2=O)O1 |
| InChI | InChI=1S/C15H13NO3/c17-12-7-10(8-5-6-8)13-14(19-12)9-3-1-2-4-11(9)16-15(13)18/h1-4,8,10H,5-7H2,(H,16,18) |
| InChIKey | GGSUMTXMWIAWDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |