About 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide
2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide (PubChem CID 63246892) has the molecular formula C6H12N4O3S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide |
| PubChem CID | 63246892 |
| Molecular Formula | C6H12N4O3S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4O3S/c1-2-13-3-4-14(11,12)10-6-7-5-8-9-6/h5H,2-4H2,1H3,(H2,7,8,9,10) |
| InChIKey | TVZFCNZVAUVKOF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
The IUPAC name of 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide (CID 63246892) is 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide.
What is the SMILES notation for 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
The canonical SMILES for 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide is CCOCCS(=O)(=O)Nc1ncn[nH]1.
What is the InChIKey of 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
The InChIKey is TVZFCNZVAUVKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O3S/c1-2-13-3-4-14(11,12)10-6-7-5-8-9-6/h5H,2-4H2,1H3,(H2,7,8,9,10).
What are the key properties of 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide has a molecular weight of 220.25 g/mol, XLogP of -0.42, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide is sourced from PubChem (CID 63246892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).