C12H23NO5S — CID 63247219
methyl 2-methyl-2-(oxolan-2-ylmethylsulfonylamino)pentanoate (PubChem CID 63247219) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is methyl 2-methyl-2-(oxolan-2-ylmethylsulfonylamino)pentanoate.
| Compound Name | methyl 2-methyl-2-(oxolan-2-ylmethylsulfonylamino)pentanoate |
|---|---|
| PubChem CID | 63247219 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl 2-methyl-2-(oxolan-2-ylmethylsulfonylamino)pentanoate |
| SMILES | CCCC(C)(NS(=O)(=O)CC1CCCO1)C(=O)OC |
| InChI | InChI=1S/C12H23NO5S/c1-4-7-12(2,11(14)17-3)13-19(15,16)9-10-6-5-8-18-10/h10,13H,4-9H2,1-3H3 |
| InChIKey | QZGRETPDYIRLHU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |