C15H16O — CID 63247450
1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-yn-1-one (PubChem CID 63247450) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-yn-1-one.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-yn-1-one |
|---|---|
| PubChem CID | 63247450 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-yn-1-one |
| SMILES | CC#CCC(=O)C1CCCc2ccccc21 |
| InChI | InChI=1S/C15H16O/c1-2-3-11-15(16)14-10-6-8-12-7-4-5-9-13(12)14/h4-5,7,9,14H,6,8,10-11H2,1H3 |
| InChIKey | BRCDIDWSBJQPKT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|