C10H13N3S — CID 63247799
N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-thiophen-3-ylmethanamine (PubChem CID 63247799) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 63247799 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-thiophen-3-ylmethanamine |
| SMILES | Cc1[nH]cnc1CNCc1ccsc1 |
| InChI | InChI=1S/C10H13N3S/c1-8-10(13-7-12-8)5-11-4-9-2-3-14-6-9/h2-3,6-7,11H,4-5H2,1H3,(H,12,13) |
| InChIKey | IETMTOMMCAQQQQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |