C13H22N2O — CID 63249658
1-[1-[1-(furan-2-yl)ethyl]piperidin-2-yl]-N-methylmethanamine (PubChem CID 63249658) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[1-[1-(furan-2-yl)ethyl]piperidin-2-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[1-(furan-2-yl)ethyl]piperidin-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63249658 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-[1-[1-(furan-2-yl)ethyl]piperidin-2-yl]-N-methylmethanamine |
| SMILES | CNCC1CCCCN1C(C)c1ccco1 |
| InChI | InChI=1S/C13H22N2O/c1-11(13-7-5-9-16-13)15-8-4-3-6-12(15)10-14-2/h5,7,9,11-12,14H,3-4,6,8,10H2,1-2H3 |
| InChIKey | WCZZIYAPCSTUCI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |