About 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one
6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one (PubChem CID 6325047) has the molecular formula C19H17NO3
and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one.
Molecular Properties
| Compound Name | 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
| PubChem CID | 6325047 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
| SMILES | COc1cc2c(c3[nH]c4ccccc4c(=O)c13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C19H17NO3/c1-19(2)9-8-12-14(23-19)10-15(22-3)16-17(12)20-13-7-5-4-6-11(13)18(16)21/h4-10H,1-3H3,(H,20,21) |
| InChIKey | NEYQKEUFRBPEJP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one?
The IUPAC name of 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one (CID 6325047) is 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one.
What is the SMILES notation for 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one?
The canonical SMILES for 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one is COc1cc2c(c3[nH]c4ccccc4c(=O)c13)C=CC(C)(C)O2.
What is the InChIKey of 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one?
The InChIKey is NEYQKEUFRBPEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3/c1-19(2)9-8-12-14(23-19)10-15(22-3)16-17(12)20-13-7-5-4-6-11(13)18(16)21/h4-10H,1-3H3,(H,20,21).
What are the key properties of 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one?
6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one has a molecular weight of 307.35 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one is sourced from PubChem (CID 6325047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).