C13H18N2 — CID 63251097
N,N-dimethyl-1,2,3,4-tetrahydronaphthalene-1-carboximidamide (PubChem CID 63251097) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N,N-dimethyl-1,2,3,4-tetrahydronaphthalene-1-carboximidamide.
| Compound Name | N,N-dimethyl-1,2,3,4-tetrahydronaphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 63251097 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N,N-dimethyl-1,2,3,4-tetrahydronaphthalene-1-carboximidamide |
| SMILES | [H]/N=C(/C1CCCc2ccccc21)N(C)C |
| InChI | InChI=1S/C13H18N2/c1-15(2)13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-4,6,8,12,14H,5,7,9H2,1-2H3/b14-13- |
| InChIKey | QRAGASWQTYNHJK-YPKPFQOOSA-N |
| XLogP | 2.65 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|